C23H14Cl3NO3S — CID 18840889
(5Z)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-(3,4-dichlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 18840889) has the molecular formula C23H14Cl3NO3S and a molecular weight of 490.80 g/mol. Its IUPAC name is (5Z)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-(3,4-dichlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-(3,4-dichlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18840889 |
| Molecular Formula | C23H14Cl3NO3S |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | (5Z)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-(3,4-dichlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cccc(OCc3ccc(Cl)cc3)c2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H14Cl3NO3S/c24-16-6-4-14(5-7-16)13-30-18-3-1-2-15(10-18)11-21-22(28)27(23(29)31-21)17-8-9-19(25)20(26)12-17/h1-12H,13H2/b21-11- |
| InChIKey | ZZECXJFDRGVZHB-NHDPSOOVSA-N |
| XLogP | 7.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|