C15H11N3O2S2 — CID 18841116
2-[(5E)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 18841116) has the molecular formula C15H11N3O2S2 and a molecular weight of 329.41 g/mol. Its IUPAC name is 2-[(5E)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-[(5E)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 18841116 |
| Molecular Formula | C15H11N3O2S2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-[(5E)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | NC(=O)c1ccccc1N1C(=O)/C(=C\c2ccc[nH]2)SC1=S |
| InChI | InChI=1S/C15H11N3O2S2/c16-13(19)10-5-1-2-6-11(10)18-14(20)12(22-15(18)21)8-9-4-3-7-17-9/h1-8,17H,(H2,16,19)/b12-8+ |
| InChIKey | ZSKOCZGFZBDRNL-XYOKQWHBSA-N |
| XLogP | 2.52 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|