C18H15N3O6S2 — CID 18841666
2-[(5Z)-5-(1-acetyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-amino-5-oxopentanoic acid (PubChem CID 18841666) has the molecular formula C18H15N3O6S2 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[(5Z)-5-(1-acetyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-amino-5-oxopentanoic acid.
| Compound Name | 2-[(5Z)-5-(1-acetyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18841666 |
| Molecular Formula | C18H15N3O6S2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 2-[(5Z)-5-(1-acetyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-amino-5-oxopentanoic acid |
| SMILES | CC(=O)N1C(=O)/C(=C2\SC(=S)N(C(CCC(N)=O)C(=O)O)C2=O)c2ccccc21 |
| InChI | InChI=1S/C18H15N3O6S2/c1-8(22)20-10-5-3-2-4-9(10)13(15(20)24)14-16(25)21(18(28)29-14)11(17(26)27)6-7-12(19)23/h2-5,11H,6-7H2,1H3,(H2,19,23)(H,26,27)/b14-13- |
| InChIKey | IYKCLMFGHODNAP-YPKPFQOOSA-N |
| XLogP | 0.87 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|