C17H14N2O6S2 — CID 3800972
2-[5-(1-methyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid (PubChem CID 3800972) has the molecular formula C17H14N2O6S2 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[5-(1-methyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid.
| Compound Name | 2-[5-(1-methyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 3800972 |
| Molecular Formula | C17H14N2O6S2 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 2-[5-(1-methyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
| SMILES | CN1C(=O)C(=C2SC(=S)N(C(CCC(=O)O)C(=O)O)C2=O)c2ccccc21 |
| InChI | InChI=1S/C17H14N2O6S2/c1-18-9-5-3-2-4-8(9)12(14(18)22)13-15(23)19(17(26)27-13)10(16(24)25)6-7-11(20)21/h2-5,10H,6-7H2,1H3,(H,20,21)(H,24,25) |
| InChIKey | DNTNVUFHTFVOQF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|