C14H10N2O4S2 — CID 171139227
2-[4-(1-methyl-2-oxoindol-3-ylidene)-5-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 171139227) has the molecular formula C14H10N2O4S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[4-(1-methyl-2-oxoindol-3-ylidene)-5-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[4-(1-methyl-2-oxoindol-3-ylidene)-5-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 171139227 |
| Molecular Formula | C14H10N2O4S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-[4-(1-methyl-2-oxoindol-3-ylidene)-5-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CN1C(=O)C(=C2C(=O)SC(=S)N2CC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C14H10N2O4S2/c1-15-8-5-3-2-4-7(8)10(12(15)19)11-13(20)22-14(21)16(11)6-9(17)18/h2-5H,6H2,1H3,(H,17,18) |
| InChIKey | MURUGLGGOPKKCW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|