C29H22ClN3O2S — CID 18844002
(5Z)-2-[(3-chloro-4-pyridinyl)imino]-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 18844002) has the molecular formula C29H22ClN3O2S and a molecular weight of 512.03 g/mol. Its IUPAC name is (5Z)-2-[(3-chloro-4-pyridinyl)imino]-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[(3-chloro-4-pyridinyl)imino]-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844002 |
| Molecular Formula | C29H22ClN3O2S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | (5Z)-2-[(3-chloro-4-pyridinyl)imino]-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(COc2cccc(/C=C3\S/C(=N\c4ccncc4Cl)N(c4ccccc4)C3=O)c2)cc1 |
| InChI | InChI=1S/C29H22ClN3O2S/c1-20-10-12-21(13-11-20)19-35-24-9-5-6-22(16-24)17-27-28(34)33(23-7-3-2-4-8-23)29(36-27)32-26-14-15-31-18-25(26)30/h2-18H,19H2,1H3/b27-17-,32-29- |
| InChIKey | NOFZTPCLPQDKFK-ZEBKITEQSA-N |
| XLogP | 7.43 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|