C21H20FN3OS — CID 18850682
(5Z)-5-[1-(4-fluorophenyl)ethylidene]-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 18850682) has the molecular formula C21H20FN3OS and a molecular weight of 381.48 g/mol. Its IUPAC name is (5Z)-5-[1-(4-fluorophenyl)ethylidene]-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[1-(4-fluorophenyl)ethylidene]-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 18850682 |
| Molecular Formula | C21H20FN3OS |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (5Z)-5-[1-(4-fluorophenyl)ethylidene]-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | C/C(=C1/SC(N2CCN(c3ccccc3)CC2)=NC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN3OS/c1-15(16-7-9-17(22)10-8-16)19-20(26)23-21(27-19)25-13-11-24(12-14-25)18-5-3-2-4-6-18/h2-10H,11-14H2,1H3/b19-15- |
| InChIKey | ISOZUKGPSIBSSG-CYVLTUHYSA-N |
| XLogP | 4.01 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|