C16H17ClN6O — CID 18851852
N'-[1-(3-chloro-4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]butanehydrazide (PubChem CID 18851852) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is N'-[1-(3-chloro-4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]butanehydrazide.
| Compound Name | N'-[1-(3-chloro-4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]butanehydrazide |
|---|---|
| PubChem CID | 18851852 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N'-[1-(3-chloro-4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]butanehydrazide |
| SMILES | CCCC(=O)NNc1ncnc2c1cnn2-c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClN6O/c1-3-4-14(24)21-22-15-12-8-20-23(16(12)19-9-18-15)11-6-5-10(2)13(17)7-11/h5-9H,3-4H2,1-2H3,(H,21,24)(H,18,19,22) |
| InChIKey | IQTYUMXSSOONRA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|