C21H20N6O — CID 17017587
N'-[1-(3,4-dimethylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2-methylbenzohydrazide (PubChem CID 17017587) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is N'-[1-(3,4-dimethylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2-methylbenzohydrazide.
| Compound Name | N'-[1-(3,4-dimethylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 17017587 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N'-[1-(3,4-dimethylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2-methylbenzohydrazide |
| SMILES | Cc1ccc(-n2ncc3c(NNC(=O)c4ccccc4C)ncnc32)cc1C |
| InChI | InChI=1S/C21H20N6O/c1-13-8-9-16(10-15(13)3)27-20-18(11-24-27)19(22-12-23-20)25-26-21(28)17-7-5-4-6-14(17)2/h4-12H,1-3H3,(H,26,28)(H,22,23,25) |
| InChIKey | SLOYXQZAUZIMLZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|