C17H13N7O — CID 18851865
N'-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)pyridine-3-carbohydrazide (PubChem CID 18851865) has the molecular formula C17H13N7O and a molecular weight of 331.34 g/mol. Its IUPAC name is N'-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)pyridine-3-carbohydrazide.
| Compound Name | N'-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 18851865 |
| Molecular Formula | C17H13N7O |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N'-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)pyridine-3-carbohydrazide |
| SMILES | O=C(NNc1ncnc2c1cnn2-c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C17H13N7O/c25-17(12-5-4-8-18-9-12)23-22-15-14-10-21-24(16(14)20-11-19-15)13-6-2-1-3-7-13/h1-11H,(H,23,25)(H,19,20,22) |
| InChIKey | MEYCDTLPTAOXPO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|