C18H13ClN6O — CID 17017298
N'-[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]benzohydrazide (PubChem CID 17017298) has the molecular formula C18H13ClN6O and a molecular weight of 364.80 g/mol. Its IUPAC name is N'-[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]benzohydrazide.
| Compound Name | N'-[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 17017298 |
| Molecular Formula | C18H13ClN6O |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N'-[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc2c1cnn2-c1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C18H13ClN6O/c19-13-7-4-8-14(9-13)25-17-15(10-22-25)16(20-11-21-17)23-24-18(26)12-5-2-1-3-6-12/h1-11H,(H,24,26)(H,20,21,23) |
| InChIKey | PMDWOTVHKWSEMU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|