C12H10ClN5 — CID 17017215
1-(3-chlorophenyl)-N-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 17017215) has the molecular formula C12H10ClN5 and a molecular weight of 259.70 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(3-chlorophenyl)-N-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 17017215 |
| Molecular Formula | C12H10ClN5 |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-(3-chlorophenyl)-N-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CNc1ncnc2c1cnn2-c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H10ClN5/c1-14-11-10-6-17-18(12(10)16-7-15-11)9-4-2-3-8(13)5-9/h2-7H,1H3,(H,14,15,16) |
| InChIKey | WVLKPURWXYRYDV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |