C19H14ClN5O3 — CID 108778450
methyl 3-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-hydroxybenzoate (PubChem CID 108778450) has the molecular formula C19H14ClN5O3 and a molecular weight of 395.81 g/mol. Its IUPAC name is methyl 3-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 108778450 |
| Molecular Formula | C19H14ClN5O3 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | methyl 3-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(Nc2ncnc3c2cnn3-c2cccc(Cl)c2)c1O |
| InChI | InChI=1S/C19H14ClN5O3/c1-28-19(27)13-6-3-7-15(16(13)26)24-17-14-9-23-25(18(14)22-10-21-17)12-5-2-4-11(20)8-12/h2-10,26H,1H3,(H,21,22,24) |
| InChIKey | ZGHSVMKGHWVKPN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|