C14H14ClN5O — CID 17017238
1-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 17017238) has the molecular formula C14H14ClN5O and a molecular weight of 303.75 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 1-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 17017238 |
| Molecular Formula | C14H14ClN5O |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | CCC(O)Nc1ncnc2c1cnn2-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H14ClN5O/c1-2-12(21)19-13-11-7-18-20(14(11)17-8-16-13)10-5-3-4-9(15)6-10/h3-8,12,21H,2H2,1H3,(H,16,17,19) |
| InChIKey | JACJRSWIRLKVHA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|