C18H13ClN6O2 — CID 18851857
N'-[1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-3-hydroxybenzohydrazide (PubChem CID 18851857) has the molecular formula C18H13ClN6O2 and a molecular weight of 380.80 g/mol. Its IUPAC name is N'-[1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-3-hydroxybenzohydrazide.
| Compound Name | N'-[1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-3-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 18851857 |
| Molecular Formula | C18H13ClN6O2 |
| Molecular Weight | 380.80 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N'-[1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-3-hydroxybenzohydrazide |
| SMILES | O=C(NNc1ncnc2c1cnn2-c1ccc(Cl)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C18H13ClN6O2/c19-12-4-6-13(7-5-12)25-17-15(9-22-25)16(20-10-21-17)23-24-18(27)11-2-1-3-14(26)8-11/h1-10,26H,(H,24,27)(H,20,21,23) |
| InChIKey | CNDWPPRMTOCHDX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|