C19H13Cl3N6O — CID 16801333
2,4-dichloro-N'-[1-(5-chloro-2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]benzohydrazide (PubChem CID 16801333) has the molecular formula C19H13Cl3N6O and a molecular weight of 447.71 g/mol. Its IUPAC name is 2,4-dichloro-N'-[1-(5-chloro-2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2,4-dichloro-N'-[1-(5-chloro-2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 16801333 |
| Molecular Formula | C19H13Cl3N6O |
| Molecular Weight | 447.71 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 2,4-dichloro-N'-[1-(5-chloro-2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]benzohydrazide |
| SMILES | Cc1ccc(Cl)cc1-n1ncc2c(NNC(=O)c3ccc(Cl)cc3Cl)ncnc21 |
| InChI | InChI=1S/C19H13Cl3N6O/c1-10-2-3-12(21)7-16(10)28-18-14(8-25-28)17(23-9-24-18)26-27-19(29)13-5-4-11(20)6-15(13)22/h2-9H,1H3,(H,27,29)(H,23,24,26) |
| InChIKey | ITNTWKSUGGTGGY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.71 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|