C17H19ClN6O — CID 8539031
N'-[1-(5-chloro-2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2,2-dimethylpropanehydrazide (PubChem CID 8539031) has the molecular formula C17H19ClN6O and a molecular weight of 358.83 g/mol. Its IUPAC name is N'-[1-(5-chloro-2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2,2-dimethylpropanehydrazide.
| Compound Name | N'-[1-(5-chloro-2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 8539031 |
| Molecular Formula | C17H19ClN6O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N'-[1-(5-chloro-2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2,2-dimethylpropanehydrazide |
| SMILES | Cc1ccc(Cl)cc1-n1ncc2c(NNC(=O)C(C)(C)C)ncnc21 |
| InChI | InChI=1S/C17H19ClN6O/c1-10-5-6-11(18)7-13(10)24-15-12(8-21-24)14(19-9-20-15)22-23-16(25)17(2,3)4/h5-9H,1-4H3,(H,23,25)(H,19,20,22) |
| InChIKey | DROYZFMWCVLNEV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|