C18H24N2O4 — CID 18851905
4-(3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 18851905) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-(3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-(3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 18851905 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-(3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC(C)C(C(=O)N1CCOCC1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C18H24N2O4/c1-10(2)15(18(23)19-5-7-24-8-6-19)20-16(21)13-11-3-4-12(9-11)14(13)17(20)22/h3-4,10-15H,5-9H2,1-2H3 |
| InChIKey | UMQICQUQXRLQQU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|