C26H20N4O6 — CID 18859292
4-(7-methoxy-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)-N-(6-nitro-1,3-benzodioxol-5-yl)benzamide (PubChem CID 18859292) has the molecular formula C26H20N4O6 and a molecular weight of 484.47 g/mol. Its IUPAC name is 4-(7-methoxy-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)-N-(6-nitro-1,3-benzodioxol-5-yl)benzamide.
| Compound Name | 4-(7-methoxy-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)-N-(6-nitro-1,3-benzodioxol-5-yl)benzamide |
|---|---|
| PubChem CID | 18859292 |
| Molecular Formula | C26H20N4O6 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 4-(7-methoxy-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)-N-(6-nitro-1,3-benzodioxol-5-yl)benzamide |
| SMILES | COc1ccc2cc3c(nc2c1)N(c1ccc(C(=O)Nc2cc4c(cc2[N+](=O)[O-])OCO4)cc1)CC3 |
| InChI | InChI=1S/C26H20N4O6/c1-34-19-7-4-16-10-17-8-9-29(25(17)27-20(16)11-19)18-5-2-15(3-6-18)26(31)28-21-12-23-24(36-14-35-23)13-22(21)30(32)33/h2-7,10-13H,8-9,14H2,1H3,(H,28,31) |
| InChIKey | CJGVCTAQTNGGST-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|