C38H36FN3O4S2 — CID 18859624
2-[9-(4-tert-butylphenyl)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(3-methylphenyl)acetamide (PubChem CID 18859624) has the molecular formula C38H36FN3O4S2 and a molecular weight of 681.86 g/mol. Its IUPAC name is 2-[9-(4-tert-butylphenyl)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[9-(4-tert-butylphenyl)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18859624 |
| Molecular Formula | C38H36FN3O4S2 |
| Molecular Weight | 681.86 g/mol |
| Exact Mass | 681.21 |
| IUPAC Name | 2-[9-(4-tert-butylphenyl)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2c3c(sc2=O)C(c2ccc(C(C)(C)C)cc2)C2C4CC(C2S3)C2C(=O)N(c3ccc(F)cc3)C(=O)C42)c1 |
| InChI | InChI=1S/C38H36FN3O4S2/c1-19-6-5-7-23(16-19)40-27(43)18-41-36-33(48-37(41)46)28(20-8-10-21(11-9-20)38(2,3)4)29-25-17-26(32(29)47-36)31-30(25)34(44)42(35(31)45)24-14-12-22(39)13-15-24/h5-16,25-26,28-32H,17-18H2,1-4H3,(H,40,43) |
| InChIKey | ULPWKMUHQHTULE-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.86 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|