C25H21NO4S2 — CID 18863261
ethyl 4-phenyl-2-[[5-(phenylsulfanylmethyl)furan-2-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 18863261) has the molecular formula C25H21NO4S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is ethyl 4-phenyl-2-[[5-(phenylsulfanylmethyl)furan-2-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-[[5-(phenylsulfanylmethyl)furan-2-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18863261 |
| Molecular Formula | C25H21NO4S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | ethyl 4-phenyl-2-[[5-(phenylsulfanylmethyl)furan-2-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1ccc(CSc2ccccc2)o1 |
| InChI | InChI=1S/C25H21NO4S2/c1-2-29-25(28)22-20(17-9-5-3-6-10-17)16-32-24(22)26-23(27)21-14-13-18(30-21)15-31-19-11-7-4-8-12-19/h3-14,16H,2,15H2,1H3,(H,26,27) |
| InChIKey | MYBYMIJJUMNXIP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|