C20H12F3N3O2S3 — CID 18865981
8-pyridin-3-yl-5-sulfanylidene-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione (PubChem CID 18865981) has the molecular formula C20H12F3N3O2S3 and a molecular weight of 479.53 g/mol. Its IUPAC name is 8-pyridin-3-yl-5-sulfanylidene-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione.
| Compound Name | 8-pyridin-3-yl-5-sulfanylidene-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
|---|---|
| PubChem CID | 18865981 |
| Molecular Formula | C20H12F3N3O2S3 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | 8-pyridin-3-yl-5-sulfanylidene-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
| SMILES | O=C1C2Sc3[nH]c(=S)sc3C(c3cccnc3)C2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H12F3N3O2S3/c21-20(22,23)10-4-1-5-11(7-10)26-17(27)13-12(9-3-2-6-24-8-9)14-16(25-19(29)31-14)30-15(13)18(26)28/h1-8,12-13,15H,(H,25,29) |
| InChIKey | MWDRHMACLILQGX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|