C21H23Cl2N3O4 — CID 18867037
2-methylpropyl 5-(2,3-dichlorophenyl)-1,3,7-trimethyl-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 18867037) has the molecular formula C21H23Cl2N3O4 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-methylpropyl 5-(2,3-dichlorophenyl)-1,3,7-trimethyl-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methylpropyl 5-(2,3-dichlorophenyl)-1,3,7-trimethyl-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 18867037 |
| Molecular Formula | C21H23Cl2N3O4 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-methylpropyl 5-(2,3-dichlorophenyl)-1,3,7-trimethyl-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OCC(C)C)C(c2cccc(Cl)c2Cl)c2c(n(C)c(=O)n(C)c2=O)N1 |
| InChI | InChI=1S/C21H23Cl2N3O4/c1-10(2)9-30-20(28)14-11(3)24-18-16(19(27)26(5)21(29)25(18)4)15(14)12-7-6-8-13(22)17(12)23/h6-8,10,15,24H,9H2,1-5H3 |
| InChIKey | BCGCCZYIYUZLQL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |