C23H29N3O7 — CID 4860472
propan-2-yl 1,3,7-trimethyl-2,4-dioxo-5-(2,4,5-trimethoxyphenyl)-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 4860472) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is propan-2-yl 1,3,7-trimethyl-2,4-dioxo-5-(2,4,5-trimethoxyphenyl)-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 1,3,7-trimethyl-2,4-dioxo-5-(2,4,5-trimethoxyphenyl)-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4860472 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | propan-2-yl 1,3,7-trimethyl-2,4-dioxo-5-(2,4,5-trimethoxyphenyl)-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COc1cc(OC)c(C2C(C(=O)OC(C)C)=C(C)Nc3c2c(=O)n(C)c(=O)n3C)cc1OC |
| InChI | InChI=1S/C23H29N3O7/c1-11(2)33-22(28)17-12(3)24-20-19(21(27)26(5)23(29)25(20)4)18(17)13-9-15(31-7)16(32-8)10-14(13)30-6/h9-11,18,24H,1-8H3 |
| InChIKey | QVCZJUBTXNLVAP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |