C29H21ClN2O4 — CID 18867883
7-chloro-1'-[(4-methylphenyl)methyl]-2-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18867883) has the molecular formula C29H21ClN2O4 and a molecular weight of 496.95 g/mol. Its IUPAC name is 7-chloro-1'-[(4-methylphenyl)methyl]-2-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 7-chloro-1'-[(4-methylphenyl)methyl]-2-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18867883 |
| Molecular Formula | C29H21ClN2O4 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 7-chloro-1'-[(4-methylphenyl)methyl]-2-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | C=CCN1C(=O)c2oc3ccc(Cl)cc3c(=O)c2C12C(=O)N(Cc1ccc(C)cc1)c1ccccc12 |
| InChI | InChI=1S/C29H21ClN2O4/c1-3-14-32-27(34)26-24(25(33)20-15-19(30)12-13-23(20)36-26)29(32)21-6-4-5-7-22(21)31(28(29)35)16-18-10-8-17(2)9-11-18/h3-13,15H,1,14,16H2,2H3 |
| InChIKey | ONVNKHWMDJRGSC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|