C28H18Cl2N2O4 — CID 3840458
7-chloro-2-[(2-chlorophenyl)methyl]-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 3840458) has the molecular formula C28H18Cl2N2O4 and a molecular weight of 517.37 g/mol. Its IUPAC name is 7-chloro-2-[(2-chlorophenyl)methyl]-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 7-chloro-2-[(2-chlorophenyl)methyl]-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 3840458 |
| Molecular Formula | C28H18Cl2N2O4 |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | 7-chloro-2-[(2-chlorophenyl)methyl]-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | C=CCN1C(=O)C2(c3ccccc31)c1c(oc3ccc(Cl)cc3c1=O)C(=O)N2Cc1ccccc1Cl |
| InChI | InChI=1S/C28H18Cl2N2O4/c1-2-13-31-21-10-6-4-8-19(21)28(27(31)35)23-24(33)18-14-17(29)11-12-22(18)36-25(23)26(34)32(28)15-16-7-3-5-9-20(16)30/h2-12,14H,1,13,15H2 |
| InChIKey | VPLZASOIQLMOJR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|