C34H24Cl2N2O4 — CID 18869848
1',2-bis[(2-chlorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869848) has the molecular formula C34H24Cl2N2O4 and a molecular weight of 595.48 g/mol. Its IUPAC name is 1',2-bis[(2-chlorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 1',2-bis[(2-chlorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869848 |
| Molecular Formula | C34H24Cl2N2O4 |
| Molecular Weight | 595.48 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | 1',2-bis[(2-chlorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1cc2oc3c(c(=O)c2cc1C)C1(C(=O)N(Cc2ccccc2Cl)c2ccccc21)N(Cc1ccccc1Cl)C3=O |
| InChI | InChI=1S/C34H24Cl2N2O4/c1-19-15-23-28(16-20(19)2)42-31-29(30(23)39)34(38(32(31)40)18-22-10-4-7-13-26(22)36)24-11-5-8-14-27(24)37(33(34)41)17-21-9-3-6-12-25(21)35/h3-16H,17-18H2,1-2H3 |
| InChIKey | GAHSEOUIVUPOPE-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.48 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |