C31H28N2O5 — CID 18869928
2-(3-hydroxypropyl)-6,7-dimethyl-1'-[(3-methylphenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869928) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-6,7-dimethyl-1'-[(3-methylphenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 2-(3-hydroxypropyl)-6,7-dimethyl-1'-[(3-methylphenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869928 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 2-(3-hydroxypropyl)-6,7-dimethyl-1'-[(3-methylphenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1cccc(CN2C(=O)C3(c4ccccc42)c2c(oc4cc(C)c(C)cc4c2=O)C(=O)N3CCCO)c1 |
| InChI | InChI=1S/C31H28N2O5/c1-18-8-6-9-21(14-18)17-32-24-11-5-4-10-23(24)31(30(32)37)26-27(35)22-15-19(2)20(3)16-25(22)38-28(26)29(36)33(31)12-7-13-34/h4-6,8-11,14-16,34H,7,12-13,17H2,1-3H3 |
| InChIKey | VYSJGOZDRGQDPE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |