C33H31FN2O5 — CID 18869744
1'-[(4-fluorophenyl)methyl]-6,7-dimethyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869744) has the molecular formula C33H31FN2O5 and a molecular weight of 554.62 g/mol. Its IUPAC name is 1'-[(4-fluorophenyl)methyl]-6,7-dimethyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 1'-[(4-fluorophenyl)methyl]-6,7-dimethyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869744 |
| Molecular Formula | C33H31FN2O5 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 1'-[(4-fluorophenyl)methyl]-6,7-dimethyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1cc2oc3c(c(=O)c2cc1C)C1(C(=O)N(Cc2ccc(F)cc2)c2ccccc21)N(CCCOC(C)C)C3=O |
| InChI | InChI=1S/C33H31FN2O5/c1-19(2)40-15-7-14-36-31(38)30-28(29(37)24-16-20(3)21(4)17-27(24)41-30)33(36)25-8-5-6-9-26(25)35(32(33)39)18-22-10-12-23(34)13-11-22/h5-6,8-13,16-17,19H,7,14-15,18H2,1-4H3 |
| InChIKey | JKZBQUDGUBVXMQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|