C28H30N2O5 — CID 41068038
(1R)-1'-ethyl-6,7-dimethyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 41068038) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is (1R)-1'-ethyl-6,7-dimethyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | (1R)-1'-ethyl-6,7-dimethyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 41068038 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (1R)-1'-ethyl-6,7-dimethyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | CCN1C(=O)[C@@]2(c3ccccc31)c1c(oc3cc(C)c(C)cc3c1=O)C(=O)N2CCCOC(C)C |
| InChI | InChI=1S/C28H30N2O5/c1-6-29-21-11-8-7-10-20(21)28(27(29)33)23-24(31)19-14-17(4)18(5)15-22(19)35-25(23)26(32)30(28)12-9-13-34-16(2)3/h7-8,10-11,14-16H,6,9,12-13H2,1-5H3/t28-/m1/s1 |
| InChIKey | WIXIHGGPEYGJAT-MUUNZHRXSA-N |
| XLogP | 4.29 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|