C25H24N2O5 — CID 40871618
(1R)-2-(3-ethoxypropyl)-1'-ethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 40871618) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is (1R)-2-(3-ethoxypropyl)-1'-ethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | (1R)-2-(3-ethoxypropyl)-1'-ethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 40871618 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (1R)-2-(3-ethoxypropyl)-1'-ethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | CCOCCCN1C(=O)c2oc3ccccc3c(=O)c2[C@]12C(=O)N(CC)c1ccccc12 |
| InChI | InChI=1S/C25H24N2O5/c1-3-26-18-12-7-6-11-17(18)25(24(26)30)20-21(28)16-10-5-8-13-19(16)32-22(20)23(29)27(25)14-9-15-31-4-2/h5-8,10-13H,3-4,9,14-15H2,1-2H3/t25-/m1/s1 |
| InChIKey | DCHOBOYSDRGLST-RUZDIDTESA-N |
| XLogP | 3.29 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|