C29H22ClFN2O5 — CID 94854890
(1S)-7-chloro-1'-[(4-fluorophenyl)methyl]-2-(3-methoxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 94854890) has the molecular formula C29H22ClFN2O5 and a molecular weight of 532.96 g/mol. Its IUPAC name is (1S)-7-chloro-1'-[(4-fluorophenyl)methyl]-2-(3-methoxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | (1S)-7-chloro-1'-[(4-fluorophenyl)methyl]-2-(3-methoxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 94854890 |
| Molecular Formula | C29H22ClFN2O5 |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | (1S)-7-chloro-1'-[(4-fluorophenyl)methyl]-2-(3-methoxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | COCCCN1C(=O)c2oc3ccc(Cl)cc3c(=O)c2[C@@]12C(=O)N(Cc1ccc(F)cc1)c1ccccc12 |
| InChI | InChI=1S/C29H22ClFN2O5/c1-37-14-4-13-33-27(35)26-24(25(34)20-15-18(30)9-12-23(20)38-26)29(33)21-5-2-3-6-22(21)32(28(29)36)16-17-7-10-19(31)11-8-17/h2-3,5-12,15H,4,13-14,16H2,1H3/t29-/m0/s1 |
| InChIKey | ZWAFCDFJGMEUQU-LJAQVGFWSA-N |
| XLogP | 4.87 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|