C29H23ClN2O5 — CID 18867833
1'-benzyl-7-chloro-2-(3-methoxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18867833) has the molecular formula C29H23ClN2O5 and a molecular weight of 514.97 g/mol. Its IUPAC name is 1'-benzyl-7-chloro-2-(3-methoxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 1'-benzyl-7-chloro-2-(3-methoxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18867833 |
| Molecular Formula | C29H23ClN2O5 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 1'-benzyl-7-chloro-2-(3-methoxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | COCCCN1C(=O)c2oc3ccc(Cl)cc3c(=O)c2C12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C29H23ClN2O5/c1-36-15-7-14-32-27(34)26-24(25(33)20-16-19(30)12-13-23(20)37-26)29(32)21-10-5-6-11-22(21)31(28(29)35)17-18-8-3-2-4-9-18/h2-6,8-13,16H,7,14-15,17H2,1H3 |
| InChIKey | LIGMIESDQFILGK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|