C35H25ClN2O6 — CID 18869844
2-(1,3-benzodioxol-5-ylmethyl)-1'-[(2-chlorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869844) has the molecular formula C35H25ClN2O6 and a molecular weight of 605.05 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1'-[(2-chlorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1'-[(2-chlorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869844 |
| Molecular Formula | C35H25ClN2O6 |
| Molecular Weight | 605.05 g/mol |
| Exact Mass | 604.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1'-[(2-chlorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1cc2oc3c(c(=O)c2cc1C)C1(C(=O)N(Cc2ccccc2Cl)c2ccccc21)N(Cc1ccc2c(c1)OCO2)C3=O |
| InChI | InChI=1S/C35H25ClN2O6/c1-19-13-23-28(14-20(19)2)44-32-30(31(23)39)35(38(33(32)40)16-21-11-12-27-29(15-21)43-18-42-27)24-8-4-6-10-26(24)37(34(35)41)17-22-7-3-5-9-25(22)36/h3-15H,16-18H2,1-2H3 |
| InChIKey | YHNAQVGWSDDSSY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.05 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |