C26H24N2O4 — CID 18869576
6,7-dimethyl-2-prop-2-enyl-1'-propylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869576) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 6,7-dimethyl-2-prop-2-enyl-1'-propylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 6,7-dimethyl-2-prop-2-enyl-1'-propylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869576 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 6,7-dimethyl-2-prop-2-enyl-1'-propylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | C=CCN1C(=O)c2oc3cc(C)c(C)cc3c(=O)c2C12C(=O)N(CCC)c1ccccc12 |
| InChI | InChI=1S/C26H24N2O4/c1-5-11-27-19-10-8-7-9-18(19)26(25(27)31)21-22(29)17-13-15(3)16(4)14-20(17)32-23(21)24(30)28(26)12-6-2/h6-10,13-14H,2,5,11-12H2,1,3-4H3 |
| InChIKey | HHDSGRCZELCOQR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|