C24H20N2O4 — CID 18869537
1',6,7-trimethyl-2-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869537) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 1',6,7-trimethyl-2-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 1',6,7-trimethyl-2-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869537 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1',6,7-trimethyl-2-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | C=CCN1C(=O)c2oc3cc(C)c(C)cc3c(=O)c2C12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C24H20N2O4/c1-5-10-26-22(28)21-19(20(27)15-11-13(2)14(3)12-18(15)30-21)24(26)16-8-6-7-9-17(16)25(4)23(24)29/h5-9,11-12H,1,10H2,2-4H3 |
| InChIKey | RIDAXDPDWJPRTF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|