C28H26N2O5 — CID 27316816
(1R)-6,7-dimethyl-2-[[(2S)-oxolan-2-yl]methyl]-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 27316816) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is (1R)-6,7-dimethyl-2-[[(2S)-oxolan-2-yl]methyl]-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | (1R)-6,7-dimethyl-2-[[(2S)-oxolan-2-yl]methyl]-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 27316816 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (1R)-6,7-dimethyl-2-[[(2S)-oxolan-2-yl]methyl]-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | C=CCN1C(=O)[C@@]2(c3ccccc31)c1c(oc3cc(C)c(C)cc3c1=O)C(=O)N2C[C@@H]1CCCO1 |
| InChI | InChI=1S/C28H26N2O5/c1-4-11-29-21-10-6-5-9-20(21)28(27(29)33)23-24(31)19-13-16(2)17(3)14-22(19)35-25(23)26(32)30(28)15-18-8-7-12-34-18/h4-6,9-10,13-14,18H,1,7-8,11-12,15H2,2-3H3/t18-,28+/m0/s1 |
| InChIKey | JDTSZDWMUITLAS-XDBZFTIUSA-N |
| XLogP | 3.82 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|