C28H23N3O4S — CID 18869630
2-(4,5-dimethyl-1,3-thiazol-2-yl)-6,7-dimethyl-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869630) has the molecular formula C28H23N3O4S and a molecular weight of 497.58 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1,3-thiazol-2-yl)-6,7-dimethyl-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 2-(4,5-dimethyl-1,3-thiazol-2-yl)-6,7-dimethyl-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869630 |
| Molecular Formula | C28H23N3O4S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 2-(4,5-dimethyl-1,3-thiazol-2-yl)-6,7-dimethyl-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | C=CCN1C(=O)C2(c3ccccc31)c1c(oc3cc(C)c(C)cc3c1=O)C(=O)N2c1nc(C)c(C)s1 |
| InChI | InChI=1S/C28H23N3O4S/c1-6-11-30-20-10-8-7-9-19(20)28(26(30)34)22-23(32)18-12-14(2)15(3)13-21(18)35-24(22)25(33)31(28)27-29-16(4)17(5)36-27/h6-10,12-13H,1,11H2,2-5H3 |
| InChIKey | FXIWRAVZPFUPAX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|