C25H17N3O5 — CID 18867316
2-(5-methyl-1,2-oxazol-3-yl)-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18867316) has the molecular formula C25H17N3O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is 2-(5-methyl-1,2-oxazol-3-yl)-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 2-(5-methyl-1,2-oxazol-3-yl)-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18867316 |
| Molecular Formula | C25H17N3O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-(5-methyl-1,2-oxazol-3-yl)-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | C=CCN1C(=O)C2(c3ccccc31)c1c(oc3ccccc3c1=O)C(=O)N2c1cc(C)on1 |
| InChI | InChI=1S/C25H17N3O5/c1-3-12-27-17-10-6-5-9-16(17)25(24(27)31)20-21(29)15-8-4-7-11-18(15)32-22(20)23(30)28(25)19-13-14(2)33-26-19/h3-11,13H,1,12H2,2H3 |
| InChIKey | WARNDPAJIQOWON-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 96.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|