C29H18ClN3O4S — CID 18868800
2-(6-chloro-1,3-benzothiazol-2-yl)-7-methyl-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18868800) has the molecular formula C29H18ClN3O4S and a molecular weight of 540.00 g/mol. Its IUPAC name is 2-(6-chloro-1,3-benzothiazol-2-yl)-7-methyl-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 2-(6-chloro-1,3-benzothiazol-2-yl)-7-methyl-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18868800 |
| Molecular Formula | C29H18ClN3O4S |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 2-(6-chloro-1,3-benzothiazol-2-yl)-7-methyl-1'-prop-2-enylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | C=CCN1C(=O)C2(c3ccccc31)c1c(oc3ccc(C)cc3c1=O)C(=O)N2c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C29H18ClN3O4S/c1-3-12-32-20-7-5-4-6-18(20)29(27(32)36)23-24(34)17-13-15(2)8-11-21(17)37-25(23)26(35)33(29)28-31-19-10-9-16(30)14-22(19)38-28/h3-11,13-14H,1,12H2,2H3 |
| InChIKey | DFDTUFWIVIGZRK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|