C36H27N3O4S — CID 18869908
6,7-dimethyl-2-(6-methyl-1,3-benzothiazol-2-yl)-1'-[(2-methylphenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869908) has the molecular formula C36H27N3O4S and a molecular weight of 597.70 g/mol. Its IUPAC name is 6,7-dimethyl-2-(6-methyl-1,3-benzothiazol-2-yl)-1'-[(2-methylphenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 6,7-dimethyl-2-(6-methyl-1,3-benzothiazol-2-yl)-1'-[(2-methylphenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869908 |
| Molecular Formula | C36H27N3O4S |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 6,7-dimethyl-2-(6-methyl-1,3-benzothiazol-2-yl)-1'-[(2-methylphenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1ccc2nc(N3C(=O)c4oc5cc(C)c(C)cc5c(=O)c4C34C(=O)N(Cc3ccccc3C)c3ccccc34)sc2c1 |
| InChI | InChI=1S/C36H27N3O4S/c1-19-13-14-26-29(15-19)44-35(37-26)39-33(41)32-30(31(40)24-16-21(3)22(4)17-28(24)43-32)36(39)25-11-7-8-12-27(25)38(34(36)42)18-23-10-6-5-9-20(23)2/h5-17H,18H2,1-4H3 |
| InChIKey | AHGJOBRFVIDLSC-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |