C34H21ClFN3O4S — CID 18868177
7-chloro-2-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1'-[(2-fluorophenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18868177) has the molecular formula C34H21ClFN3O4S and a molecular weight of 622.08 g/mol. Its IUPAC name is 7-chloro-2-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1'-[(2-fluorophenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 7-chloro-2-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1'-[(2-fluorophenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18868177 |
| Molecular Formula | C34H21ClFN3O4S |
| Molecular Weight | 622.08 g/mol |
| Exact Mass | 621.09 |
| IUPAC Name | 7-chloro-2-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1'-[(2-fluorophenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1cc(C)c2nc(N3C(=O)c4oc5ccc(Cl)cc5c(=O)c4C34C(=O)N(Cc3ccccc3F)c3ccccc34)sc2c1 |
| InChI | InChI=1S/C34H21ClFN3O4S/c1-17-13-18(2)28-26(14-17)44-33(37-28)39-31(41)30-27(29(40)21-15-20(35)11-12-25(21)43-30)34(39)22-8-4-6-10-24(22)38(32(34)42)16-19-7-3-5-9-23(19)36/h3-15H,16H2,1-2H3 |
| InChIKey | DTFVTQANJJXTCM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.08 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |