C35H24FN3O5S — CID 18869995
1'-[(2-fluorophenyl)methyl]-2-(6-methoxy-1,3-benzothiazol-2-yl)-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869995) has the molecular formula C35H24FN3O5S and a molecular weight of 617.66 g/mol. Its IUPAC name is 1'-[(2-fluorophenyl)methyl]-2-(6-methoxy-1,3-benzothiazol-2-yl)-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 1'-[(2-fluorophenyl)methyl]-2-(6-methoxy-1,3-benzothiazol-2-yl)-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869995 |
| Molecular Formula | C35H24FN3O5S |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.14 |
| IUPAC Name | 1'-[(2-fluorophenyl)methyl]-2-(6-methoxy-1,3-benzothiazol-2-yl)-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | COc1ccc2nc(N3C(=O)c4oc5cc(C)c(C)cc5c(=O)c4C34C(=O)N(Cc3ccccc3F)c3ccccc34)sc2c1 |
| InChI | InChI=1S/C35H24FN3O5S/c1-18-14-22-27(15-19(18)2)44-31-29(30(22)40)35(39(32(31)41)34-37-25-13-12-21(43-3)16-28(25)45-34)23-9-5-7-11-26(23)38(33(35)42)17-20-8-4-6-10-24(20)36/h4-16H,17H2,1-3H3 |
| InChIKey | UJEVRGWPTMAGKO-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |