C29H21N3O5S — CID 18869557
2-(6-methoxy-1,3-benzothiazol-2-yl)-1',6,7-trimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869557) has the molecular formula C29H21N3O5S and a molecular weight of 523.57 g/mol. Its IUPAC name is 2-(6-methoxy-1,3-benzothiazol-2-yl)-1',6,7-trimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 2-(6-methoxy-1,3-benzothiazol-2-yl)-1',6,7-trimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869557 |
| Molecular Formula | C29H21N3O5S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 2-(6-methoxy-1,3-benzothiazol-2-yl)-1',6,7-trimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | COc1ccc2nc(N3C(=O)c4oc5cc(C)c(C)cc5c(=O)c4C34C(=O)N(C)c3ccccc34)sc2c1 |
| InChI | InChI=1S/C29H21N3O5S/c1-14-11-17-21(12-15(14)2)37-25-23(24(17)33)29(18-7-5-6-8-20(18)31(3)27(29)35)32(26(25)34)28-30-19-10-9-16(36-4)13-22(19)38-28/h5-13H,1-4H3 |
| InChIKey | OJVRDMWDJSDGMW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |