C36H26FN3O5S — CID 18869771
2-(6-ethoxy-1,3-benzothiazol-2-yl)-1'-[(4-fluorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869771) has the molecular formula C36H26FN3O5S and a molecular weight of 631.69 g/mol. Its IUPAC name is 2-(6-ethoxy-1,3-benzothiazol-2-yl)-1'-[(4-fluorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 2-(6-ethoxy-1,3-benzothiazol-2-yl)-1'-[(4-fluorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869771 |
| Molecular Formula | C36H26FN3O5S |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | 2-(6-ethoxy-1,3-benzothiazol-2-yl)-1'-[(4-fluorophenyl)methyl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | CCOc1ccc2nc(N3C(=O)c4oc5cc(C)c(C)cc5c(=O)c4C34C(=O)N(Cc3ccc(F)cc3)c3ccccc34)sc2c1 |
| InChI | InChI=1S/C36H26FN3O5S/c1-4-44-23-13-14-26-29(17-23)46-35(38-26)40-33(42)32-30(31(41)24-15-19(2)20(3)16-28(24)45-32)36(40)25-7-5-6-8-27(25)39(34(36)43)18-21-9-11-22(37)12-10-21/h5-17H,4,18H2,1-3H3 |
| InChIKey | HBMMXLJAMLZZMP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |