C22H19Cl2NO3 — CID 18870437
N-(2,3-dichlorophenyl)-2-[4-(3,5-dimethylphenoxy)phenoxy]acetamide (PubChem CID 18870437) has the molecular formula C22H19Cl2NO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[4-(3,5-dimethylphenoxy)phenoxy]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[4-(3,5-dimethylphenoxy)phenoxy]acetamide |
|---|---|
| PubChem CID | 18870437 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[4-(3,5-dimethylphenoxy)phenoxy]acetamide |
| SMILES | Cc1cc(C)cc(Oc2ccc(OCC(=O)Nc3cccc(Cl)c3Cl)cc2)c1 |
| InChI | InChI=1S/C22H19Cl2NO3/c1-14-10-15(2)12-18(11-14)28-17-8-6-16(7-9-17)27-13-21(26)25-20-5-3-4-19(23)22(20)24/h3-12H,13H2,1-2H3,(H,25,26) |
| InChIKey | BLDBRUGZXNBYNF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |