C28H21ClN2O2 — CID 18871547
2-[5-(2-chlorophenyl)furan-2-yl]-N-(1-phenylethyl)quinoline-4-carboxamide (PubChem CID 18871547) has the molecular formula C28H21ClN2O2 and a molecular weight of 452.94 g/mol. Its IUPAC name is 2-[5-(2-chlorophenyl)furan-2-yl]-N-(1-phenylethyl)quinoline-4-carboxamide.
| Compound Name | 2-[5-(2-chlorophenyl)furan-2-yl]-N-(1-phenylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18871547 |
| Molecular Formula | C28H21ClN2O2 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[5-(2-chlorophenyl)furan-2-yl]-N-(1-phenylethyl)quinoline-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccc(-c3ccccc3Cl)o2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C28H21ClN2O2/c1-18(19-9-3-2-4-10-19)30-28(32)22-17-25(31-24-14-8-6-11-20(22)24)27-16-15-26(33-27)21-12-5-7-13-23(21)29/h2-18H,1H3,(H,30,32) |
| InChIKey | ORCHFEJTYBXJOF-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |