C18H14ClFN2O3 — CID 18872065
N'-[2-(5-chloro-6-methyl-1-benzofuran-3-yl)acetyl]-2-fluorobenzohydrazide (PubChem CID 18872065) has the molecular formula C18H14ClFN2O3 and a molecular weight of 360.77 g/mol. Its IUPAC name is N'-[2-(5-chloro-6-methyl-1-benzofuran-3-yl)acetyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[2-(5-chloro-6-methyl-1-benzofuran-3-yl)acetyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 18872065 |
| Molecular Formula | C18H14ClFN2O3 |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N'-[2-(5-chloro-6-methyl-1-benzofuran-3-yl)acetyl]-2-fluorobenzohydrazide |
| SMILES | Cc1cc2occ(CC(=O)NNC(=O)c3ccccc3F)c2cc1Cl |
| InChI | InChI=1S/C18H14ClFN2O3/c1-10-6-16-13(8-14(10)19)11(9-25-16)7-17(23)21-22-18(24)12-4-2-3-5-15(12)20/h2-6,8-9H,7H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | HTZVZFJDGGTIPK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|