C20H17ClN2O3 — CID 35931058
2-chloro-N'-[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]benzohydrazide (PubChem CID 35931058) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 2-chloro-N'-[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 35931058 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-chloro-N'-[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]benzohydrazide |
| SMILES | O=C(Cc1coc2cc3c(cc12)CCC3)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN2O3/c21-17-7-2-1-6-15(17)20(25)23-22-19(24)10-14-11-26-18-9-13-5-3-4-12(13)8-16(14)18/h1-2,6-9,11H,3-5,10H2,(H,22,24)(H,23,25) |
| InChIKey | NBNKIYUPHCYQCL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|