C19H16Cl2N2O2 — CID 4847739
N-(4-amino-3,5-dichlorophenyl)-2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetamide (PubChem CID 4847739) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 4847739 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetamide |
| SMILES | Nc1c(Cl)cc(NC(=O)Cc2coc3cc4c(cc23)CCC4)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O2/c20-15-7-13(8-16(21)19(15)22)23-18(24)6-12-9-25-17-5-11-3-1-2-10(11)4-14(12)17/h4-5,7-9H,1-3,6,22H2,(H,23,24) |
| InChIKey | CBDDYDNKFAWLGR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|